C23H27F3N2O7 — CID 158179995
[(3aR,7aR)-7a-(4-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone;molecular hydrogen (PubChem CID 158179995) has the molecular formula C23H27F3N2O7 and a molecular weight of 500.47 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(4-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone;molecular hydrogen.
| Compound Name | [(3aR,7aR)-7a-(4-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone;molecular hydrogen |
|---|---|
| PubChem CID | 158179995 |
| Molecular Formula | C23H27F3N2O7 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [(3aR,7aR)-7a-(4-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone;molecular hydrogen |
| SMILES | COc1ccnc([C@]23CCN(C(=O)c4ccc(OCCOC(F)(F)F)c(OC)c4)C[C@H]2OCO3)c1.[H][H] |
| InChI | InChI=1S/C23H25F3N2O7.H2/c1-30-16-5-7-27-19(12-16)22-6-8-28(13-20(22)33-14-35-22)21(29)15-3-4-17(18(11-15)31-2)32-9-10-34-23(24,25)26;/h3-5,7,11-12,20H,6,8-10,13-14H2,1-2H3;1H/t20-,22-;/m1./s1 |
| InChIKey | FYLWCCIEQWOETL-BNBNXSKYSA-N |
| XLogP | 3.37 |
| TPSA | 88.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|