C19H18F4N2O5S — CID 121387586
[7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-fluoro-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 121387586) has the molecular formula C19H18F4N2O5S and a molecular weight of 462.42 g/mol. Its IUPAC name is [7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-fluoro-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | [7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-fluoro-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 121387586 |
| Molecular Formula | C19H18F4N2O5S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | [7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-fluoro-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCCOC(F)(F)F)c(F)c1)N1CCC2(c3nccs3)OCOC2C1 |
| InChI | InChI=1S/C19H18F4N2O5S/c20-13-9-12(1-2-14(13)27-6-7-29-19(21,22)23)16(26)25-5-3-18(17-24-4-8-31-17)15(10-25)28-11-30-18/h1-2,4,8-9,15H,3,5-7,10-11H2 |
| InChIKey | UJLPHMYPWURFPO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|