C20H21F3N2O6S — CID 153321324
[(3aR,7aR)-7a-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 153321324) has the molecular formula C20H21F3N2O6S and a molecular weight of 474.46 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 153321324 |
| Molecular Formula | C20H21F3N2O6S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [(3aR,7aR)-7a-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@]3(c4cscn4)OCO[C@@H]3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O6S/c1-27-15-8-13(2-3-14(15)28-6-7-30-20(21,22)23)18(26)25-5-4-19(16-10-32-11-24-16)17(9-25)29-12-31-19/h2-3,8,10-11,17H,4-7,9,12H2,1H3/t17-,19-/m1/s1 |
| InChIKey | ZBBZEKAUKPKGLT-IEBWSBKVSA-N |
| XLogP | 3.18 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|