C20H22F3N3O6S — CID 121387601
[7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone (PubChem CID 121387601) has the molecular formula C20H22F3N3O6S and a molecular weight of 489.47 g/mol. Its IUPAC name is [7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone.
| Compound Name | [7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 121387601 |
| Molecular Formula | C20H22F3N3O6S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
| SMILES | COc1nc(C(=O)N2CCC3(c4csc(C)n4)OCOC3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O6S/c1-12-24-15(10-33-12)19-5-6-26(9-16(19)30-11-32-19)18(27)13-3-4-14(17(25-13)28-2)29-7-8-31-20(21,22)23/h3-4,10,16H,5-9,11H2,1-2H3 |
| InChIKey | BIZRUALHRQNXKS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|