C22H23F3N2O6 — CID 121387403
[(7aR)-2,2-dideuterio-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone (PubChem CID 121387403) has the molecular formula C22H23F3N2O6 and a molecular weight of 470.44 g/mol. Its IUPAC name is [(7aR)-2,2-dideuterio-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone.
| Compound Name | [(7aR)-2,2-dideuterio-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 121387403 |
| Molecular Formula | C22H23F3N2O6 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [(7aR)-2,2-dideuterio-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
| SMILES | [2H]C1([2H])OC2CN(C(=O)c3ccc(OCCOC(F)(F)F)c(OC)n3)CC[C@]2(c2ccccc2)O1 |
| InChI | InChI=1S/C22H23F3N2O6/c1-29-19-17(30-11-12-32-22(23,24)25)8-7-16(26-19)20(28)27-10-9-21(15-5-3-2-4-6-15)18(13-27)31-14-33-21/h2-8,18H,9-14H2,1H3/t18?,21-/m1/s1/i14D2 |
| InChIKey | PGVQPNZEUADZBW-ULTFUSIESA-N |
| XLogP | 3.12 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|