C21H22F3N3O5 — CID 121387779
(2,2-dideuterio-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[6-methyl-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone (PubChem CID 121387779) has the molecular formula C21H22F3N3O5 and a molecular weight of 455.43 g/mol. Its IUPAC name is (2,2-dideuterio-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[6-methyl-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone.
| Compound Name | (2,2-dideuterio-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[6-methyl-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 121387779 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (2,2-dideuterio-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[6-methyl-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
| SMILES | [2H]C1([2H])OC2CN(C(=O)c3ccc(OCCOC(F)(F)F)c(C)n3)CCC2(c2ccccn2)O1 |
| InChI | InChI=1S/C21H22F3N3O5/c1-14-16(29-10-11-31-21(22,23)24)6-5-15(26-14)19(28)27-9-7-20(17-4-2-3-8-25-17)18(12-27)30-13-32-20/h2-6,8,18H,7,9-13H2,1H3/i13D2 |
| InChIKey | FSWQXQYMNOREAT-KLTYLHELSA-N |
| XLogP | 2.81 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|