C21H24F3N3O6S — CID 121387351
[(7aR)-7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-ethoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone (PubChem CID 121387351) has the molecular formula C21H24F3N3O6S and a molecular weight of 503.50 g/mol. Its IUPAC name is [(7aR)-7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-ethoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone.
| Compound Name | [(7aR)-7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-ethoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 121387351 |
| Molecular Formula | C21H24F3N3O6S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | [(7aR)-7a-(2-methyl-1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-ethoxy-5-[2-(trifluoromethoxy)ethoxy]-2-pyridinyl]methanone |
| SMILES | CCOc1nc(C(=O)N2CC[C@]3(c4csc(C)n4)OCOC3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C21H24F3N3O6S/c1-3-29-18-15(30-8-9-32-21(22,23)24)5-4-14(26-18)19(28)27-7-6-20(16-11-34-13(2)25-16)17(10-27)31-12-33-20/h4-5,11,17H,3,6-10,12H2,1-2H3/t17?,20-/m1/s1 |
| InChIKey | BANQPVLZPGBWLJ-UUSAFJCLSA-N |
| XLogP | 3.27 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|