C24H23F5N2O5 — CID 153321321
[(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[(2,2,3,3-tetrafluorocyclobutyl)methoxy]-2-pyridinyl]methanone (PubChem CID 153321321) has the molecular formula C24H23F5N2O5 and a molecular weight of 514.45 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[(2,2,3,3-tetrafluorocyclobutyl)methoxy]-2-pyridinyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[(2,2,3,3-tetrafluorocyclobutyl)methoxy]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 153321321 |
| Molecular Formula | C24H23F5N2O5 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-[(2,2,3,3-tetrafluorocyclobutyl)methoxy]-2-pyridinyl]methanone |
| SMILES | COc1nc(C(=O)N2CC[C@]3(c4cccc(F)c4)OCO[C@@H]3C2)ccc1OCC1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C24H23F5N2O5/c1-33-20-18(34-12-15-10-23(26,27)24(15,28)29)6-5-17(30-20)21(32)31-8-7-22(19(11-31)35-13-36-22)14-3-2-4-16(25)9-14/h2-6,9,15,19H,7-8,10-13H2,1H3/t15?,19-,22-/m1/s1 |
| InChIKey | LBZCSJRCIVGWNH-ZGELDQQJSA-N |
| XLogP | 4.01 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|