C24H22N2O3 — CID 24828561
(2,2-diphenyl-[1,3]dioxolo[4,5-c]pyridin-6-yl)-piperidin-1-ylmethanone (PubChem CID 24828561) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2,2-diphenyl-[1,3]dioxolo[4,5-c]pyridin-6-yl)-piperidin-1-ylmethanone.
| Compound Name | (2,2-diphenyl-[1,3]dioxolo[4,5-c]pyridin-6-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 24828561 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (2,2-diphenyl-[1,3]dioxolo[4,5-c]pyridin-6-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc2c(cn1)OC(c1ccccc1)(c1ccccc1)O2)N1CCCCC1 |
| InChI | InChI=1S/C24H22N2O3/c27-23(26-14-8-3-9-15-26)20-16-21-22(17-25-20)29-24(28-21,18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,16-17H,3,8-9,14-15H2 |
| InChIKey | AGWFBLXHVMWDGS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |