C22H20F6N2O5 — CID 121387508
[(7aR)-7a-(2,3-difluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methanone (PubChem CID 121387508) has the molecular formula C22H20F6N2O5 and a molecular weight of 506.40 g/mol. Its IUPAC name is [(7aR)-7a-(2,3-difluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methanone.
| Compound Name | [(7aR)-7a-(2,3-difluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 121387508 |
| Molecular Formula | C22H20F6N2O5 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [(7aR)-7a-(2,3-difluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[6-methoxy-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methanone |
| SMILES | COc1nc(C(=O)N2CC[C@]3(c4cccc(F)c4F)OCOC3C2)ccc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C22H20F6N2O5/c1-32-18-15(33-10-22(27,28)20(25)26)6-5-14(29-18)19(31)30-8-7-21(16(9-30)34-11-35-21)12-3-2-4-13(23)17(12)24/h2-6,16,20H,7-11H2,1H3/t16?,21-/m1/s1 |
| InChIKey | DJSJHUPSMMUXML-CAWMZFRYSA-N |
| XLogP | 3.76 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|