C24H24F5NO5 — CID 138473969
[(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-(3,3,4,4-tetrafluorobutan-2-yloxy)phenyl]methanone (PubChem CID 138473969) has the molecular formula C24H24F5NO5 and a molecular weight of 501.45 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-(3,3,4,4-tetrafluorobutan-2-yloxy)phenyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-(3,3,4,4-tetrafluorobutan-2-yloxy)phenyl]methanone |
|---|---|
| PubChem CID | 138473969 |
| Molecular Formula | C24H24F5NO5 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-(3,3,4,4-tetrafluorobutan-2-yloxy)phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@]3(c4cccc(F)c4)OCO[C@@H]3C2)ccc1OC(C)C(F)(F)C(F)F |
| InChI | InChI=1S/C24H24F5NO5/c1-14(24(28,29)22(26)27)35-18-7-6-15(10-19(18)32-2)21(31)30-9-8-23(20(12-30)33-13-34-23)16-4-3-5-17(25)11-16/h3-7,10-11,14,20,22H,8-9,12-13H2,1-2H3/t14?,20-,23-/m1/s1 |
| InChIKey | CJXGSBYLLVXHBH-OMGIXWIWSA-N |
| XLogP | 4.62 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|