C19H19FN2O5 — CID 172721417
[(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[5-(hydroxymethoxy)-2-pyridinyl]methanone (PubChem CID 172721417) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[5-(hydroxymethoxy)-2-pyridinyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[5-(hydroxymethoxy)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 172721417 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(3aR,7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[5-(hydroxymethoxy)-2-pyridinyl]methanone |
| SMILES | O=C(c1ccc(OCO)cn1)N1CC[C@]2(c3cccc(F)c3)OCO[C@@H]2C1 |
| InChI | InChI=1S/C19H19FN2O5/c20-14-3-1-2-13(8-14)19-6-7-22(10-17(19)26-12-27-19)18(24)16-5-4-15(9-21-16)25-11-23/h1-5,8-9,17,23H,6-7,10-12H2/t17-,19-/m1/s1 |
| InChIKey | GOIQVKOISAXHGO-IEBWSBKVSA-N |
| XLogP | 1.66 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|