C27H34N6O8S — CID 138474097
(2S,3S,4R,6S)-6-[4-[[2-[[4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-7-carbonyl]-methylamino]ethyl-methylcarbamothioyl]oxymethyl]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid (PubChem CID 138474097) has the molecular formula C27H34N6O8S and a molecular weight of 602.67 g/mol. Its IUPAC name is (2S,3S,4R,6S)-6-[4-[[2-[[4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-7-carbonyl]-methylamino]ethyl-methylcarbamothioyl]oxymethyl]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,6S)-6-[4-[[2-[[4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-7-carbonyl]-methylamino]ethyl-methylcarbamothioyl]oxymethyl]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 138474097 |
| Molecular Formula | C27H34N6O8S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | (2S,3S,4R,6S)-6-[4-[[2-[[4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-7-carbonyl]-methylamino]ethyl-methylcarbamothioyl]oxymethyl]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid |
| SMILES | CN(CCN(C)C(=S)OCc1ccc(O[C@H]2C[C@@H](O)[C@H](O)[C@@H](C(=O)O)O2)cc1)C(=O)n1ccc2c(N(C)C)ncnc21 |
| InChI | InChI=1S/C27H34N6O8S/c1-30(2)23-18-9-10-33(24(18)29-15-28-23)26(38)31(3)11-12-32(4)27(42)39-14-16-5-7-17(8-6-16)40-20-13-19(34)21(35)22(41-20)25(36)37/h5-10,15,19-22,34-35H,11-14H2,1-4H3,(H,36,37)/t19-,20-,21+,22+/m1/s1 |
| InChIKey | BDOMQDIBIINDOR-CZYKHXBRSA-N |
| XLogP | 1.13 |
| TPSA | 162.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|