C20H16FN3O2 — CID 138474219
[6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridin-3-yl]methanediol (PubChem CID 138474219) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is [6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridin-3-yl]methanediol.
| Compound Name | [6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridin-3-yl]methanediol |
|---|---|
| PubChem CID | 138474219 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridin-3-yl]methanediol |
| SMILES | Cc1cc(-c2ncccc2-c2ccc3cnc(C(O)O)n3c2)ccc1F |
| InChI | InChI=1S/C20H16FN3O2/c1-12-9-13(5-7-17(12)21)18-16(3-2-8-22-18)14-4-6-15-10-23-19(20(25)26)24(15)11-14/h2-11,20,25-26H,1H3 |
| InChIKey | KOYIZUALKSJKJL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|