C27H22FN5O2 — CID 139495259
N-[3-[amino(hydroxy)methyl]phenyl]-6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 139495259) has the molecular formula C27H22FN5O2 and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[3-[amino(hydroxy)methyl]phenyl]-6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[3-[amino(hydroxy)methyl]phenyl]-6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139495259 |
| Molecular Formula | C27H22FN5O2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[3-[amino(hydroxy)methyl]phenyl]-6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1cc(-c2ncccc2-c2ccc3ncc(C(=O)Nc4cccc(C(N)O)c4)n3c2)ccc1F |
| InChI | InChI=1S/C27H22FN5O2/c1-16-12-17(7-9-22(16)28)25-21(6-3-11-30-25)19-8-10-24-31-14-23(33(24)15-19)27(35)32-20-5-2-4-18(13-20)26(29)34/h2-15,26,34H,29H2,1H3,(H,32,35) |
| InChIKey | LBULYYXIQGKNLY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|