C31H54F2N6O8 — CID 138478901
9-(aminomethyl)-12-butan-2-yl-18,18-difluoro-19-hexyl-6-(1-hydroxyethyl)-16-methyl-15-(2-methylpropyl)-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone (PubChem CID 138478901) has the molecular formula C31H54F2N6O8 and a molecular weight of 676.80 g/mol. Its IUPAC name is 9-(aminomethyl)-12-butan-2-yl-18,18-difluoro-19-hexyl-6-(1-hydroxyethyl)-16-methyl-15-(2-methylpropyl)-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone.
| Compound Name | 9-(aminomethyl)-12-butan-2-yl-18,18-difluoro-19-hexyl-6-(1-hydroxyethyl)-16-methyl-15-(2-methylpropyl)-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 138478901 |
| Molecular Formula | C31H54F2N6O8 |
| Molecular Weight | 676.80 g/mol |
| Exact Mass | 676.40 |
| IUPAC Name | 9-(aminomethyl)-12-butan-2-yl-18,18-difluoro-19-hexyl-6-(1-hydroxyethyl)-16-methyl-15-(2-methylpropyl)-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone |
| SMILES | CCCCCCC1OC(=O)CNC(=O)C(C(C)O)NC(=O)C(CN)NC(=O)C(C(C)CC)NC(=O)C(CC(C)C)N(C)C(=O)C1(F)F |
| InChI | InChI=1S/C31H54F2N6O8/c1-8-10-11-12-13-22-31(32,33)30(46)39(7)21(14-17(3)4)27(43)37-24(18(5)9-2)29(45)36-20(15-34)26(42)38-25(19(6)40)28(44)35-16-23(41)47-22/h17-22,24-25,40H,8-16,34H2,1-7H3,(H,35,44)(H,36,45)(H,37,43)(H,38,42) |
| InChIKey | UJLVJWGSPHUCCH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 209.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.80 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|