C24H31NO4 — CID 138481049
tert-butyl 2-[hydroxy-(3-phenylmethoxyphenyl)methyl]-5-methylpyrrolidine-1-carboxylate (PubChem CID 138481049) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl 2-[hydroxy-(3-phenylmethoxyphenyl)methyl]-5-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[hydroxy-(3-phenylmethoxyphenyl)methyl]-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138481049 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | tert-butyl 2-[hydroxy-(3-phenylmethoxyphenyl)methyl]-5-methylpyrrolidine-1-carboxylate |
| SMILES | CC1CCC(C(O)c2cccc(OCc3ccccc3)c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO4/c1-17-13-14-21(25(17)23(27)29-24(2,3)4)22(26)19-11-8-12-20(15-19)28-16-18-9-6-5-7-10-18/h5-12,15,17,21-22,26H,13-14,16H2,1-4H3 |
| InChIKey | BALAYTUVXWQJTE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |