C17H24N2O2 — CID 138483017
[(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl 2-amino-2-phenylacetate (PubChem CID 138483017) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl 2-amino-2-phenylacetate.
| Compound Name | [(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl 2-amino-2-phenylacetate |
|---|---|
| PubChem CID | 138483017 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl 2-amino-2-phenylacetate |
| SMILES | CN1C2CC[C@@H]1CC(COC(=O)C(N)c1ccccc1)C2 |
| InChI | InChI=1S/C17H24N2O2/c1-19-14-7-8-15(19)10-12(9-14)11-21-17(20)16(18)13-5-3-2-4-6-13/h2-6,12,14-16H,7-11,18H2,1H3/t12?,14-,15?,16?/m1/s1 |
| InChIKey | KASVFBQYYRRHSD-WUCYIENKSA-N |
| XLogP | 2.10 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |