C17H26N2O2 — CID 138483088
(1-methylpiperidin-4-yl)methyl 3-(methylamino)-2-phenylpropanoate (PubChem CID 138483088) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)methyl 3-(methylamino)-2-phenylpropanoate.
| Compound Name | (1-methylpiperidin-4-yl)methyl 3-(methylamino)-2-phenylpropanoate |
|---|---|
| PubChem CID | 138483088 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (1-methylpiperidin-4-yl)methyl 3-(methylamino)-2-phenylpropanoate |
| SMILES | CNCC(C(=O)OCC1CCN(C)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-18-12-16(15-6-4-3-5-7-15)17(20)21-13-14-8-10-19(2)11-9-14/h3-7,14,16,18H,8-13H2,1-2H3 |
| InChIKey | WGWYGWPINVJDGX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |