C17H28N4O — CID 142337279
(1-methylpiperidin-4-yl)methyl (1E)-3-amino-2-methyl-N-phenylpropanehydrazonate (PubChem CID 142337279) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)methyl (1E)-3-amino-2-methyl-N-phenylpropanehydrazonate.
| Compound Name | (1-methylpiperidin-4-yl)methyl (1E)-3-amino-2-methyl-N-phenylpropanehydrazonate |
|---|---|
| PubChem CID | 142337279 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (1-methylpiperidin-4-yl)methyl (1E)-3-amino-2-methyl-N-phenylpropanehydrazonate |
| SMILES | CC(CN)/C(=N\Nc1ccccc1)OCC1CCN(C)CC1 |
| InChI | InChI=1S/C17H28N4O/c1-14(12-18)17(20-19-16-6-4-3-5-7-16)22-13-15-8-10-21(2)11-9-15/h3-7,14-15,19H,8-13,18H2,1-2H3/b20-17+ |
| InChIKey | KXCQRTOWTJOSPR-LVZFUZTISA-N |
| XLogP | 2.37 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|