C14H16I3NO2 — CID 146365541
(1-methylpiperidin-4-yl)methyl 2,3,6-triiodobenzoate (PubChem CID 146365541) has the molecular formula C14H16I3NO2 and a molecular weight of 611.00 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)methyl 2,3,6-triiodobenzoate.
| Compound Name | (1-methylpiperidin-4-yl)methyl 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 146365541 |
| Molecular Formula | C14H16I3NO2 |
| Molecular Weight | 611.00 g/mol |
| Exact Mass | 610.83 |
| IUPAC Name | (1-methylpiperidin-4-yl)methyl 2,3,6-triiodobenzoate |
| SMILES | CN1CCC(COC(=O)c2c(I)ccc(I)c2I)CC1 |
| InChI | InChI=1S/C14H16I3NO2/c1-18-6-4-9(5-7-18)8-20-14(19)12-10(15)2-3-11(16)13(12)17/h2-3,9H,4-8H2,1H3 |
| InChIKey | PJZFWWKEUPTALI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.00 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|