C20H27ClN2O2 — CID 54331187
(1-butylpiperidin-4-yl)methyl 2-chloro-1-methylindole-3-carboxylate (PubChem CID 54331187) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is (1-butylpiperidin-4-yl)methyl 2-chloro-1-methylindole-3-carboxylate.
| Compound Name | (1-butylpiperidin-4-yl)methyl 2-chloro-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 54331187 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (1-butylpiperidin-4-yl)methyl 2-chloro-1-methylindole-3-carboxylate |
| SMILES | CCCCN1CCC(COC(=O)c2c(Cl)n(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H27ClN2O2/c1-3-4-11-23-12-9-15(10-13-23)14-25-20(24)18-16-7-5-6-8-17(16)22(2)19(18)21/h5-8,15H,3-4,9-14H2,1-2H3 |
| InChIKey | SYLUCTZJYJQINQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |