C19H28ClNO — CID 57005847
4-(4-butylpiperidin-1-yl)-1-(2-chlorophenyl)butan-1-one (PubChem CID 57005847) has the molecular formula C19H28ClNO and a molecular weight of 321.89 g/mol. Its IUPAC name is 4-(4-butylpiperidin-1-yl)-1-(2-chlorophenyl)butan-1-one.
| Compound Name | 4-(4-butylpiperidin-1-yl)-1-(2-chlorophenyl)butan-1-one |
|---|---|
| PubChem CID | 57005847 |
| Molecular Formula | C19H28ClNO |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 4-(4-butylpiperidin-1-yl)-1-(2-chlorophenyl)butan-1-one |
| SMILES | CCCCC1CCN(CCCC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClNO/c1-2-3-7-16-11-14-21(15-12-16)13-6-10-19(22)17-8-4-5-9-18(17)20/h4-5,8-9,16H,2-3,6-7,10-15H2,1H3 |
| InChIKey | OTQXNIUSVXQIPC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |