C19H30ClN3O3 — CID 21467241
(1-butylpiperidin-4-yl)methyl 6-amino-5-chloro-2-propoxypyridine-3-carboxylate (PubChem CID 21467241) has the molecular formula C19H30ClN3O3 and a molecular weight of 383.92 g/mol. Its IUPAC name is (1-butylpiperidin-4-yl)methyl 6-amino-5-chloro-2-propoxypyridine-3-carboxylate.
| Compound Name | (1-butylpiperidin-4-yl)methyl 6-amino-5-chloro-2-propoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 21467241 |
| Molecular Formula | C19H30ClN3O3 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (1-butylpiperidin-4-yl)methyl 6-amino-5-chloro-2-propoxypyridine-3-carboxylate |
| SMILES | CCCCN1CCC(COC(=O)c2cc(Cl)c(N)nc2OCCC)CC1 |
| InChI | InChI=1S/C19H30ClN3O3/c1-3-5-8-23-9-6-14(7-10-23)13-26-19(24)15-12-16(20)17(21)22-18(15)25-11-4-2/h12,14H,3-11,13H2,1-2H3,(H2,21,22) |
| InChIKey | BLJPRLZKBNKTQN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |