C19H26ClN3O2 — CID 70055953
4-amino-2-[(1-butylpiperidin-4-yl)methyl]-5-chloro-1-benzofuran-7-carboxamide (PubChem CID 70055953) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 4-amino-2-[(1-butylpiperidin-4-yl)methyl]-5-chloro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-2-[(1-butylpiperidin-4-yl)methyl]-5-chloro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 70055953 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-amino-2-[(1-butylpiperidin-4-yl)methyl]-5-chloro-1-benzofuran-7-carboxamide |
| SMILES | CCCCN1CCC(Cc2cc3c(N)c(Cl)cc(C(N)=O)c3o2)CC1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-2-3-6-23-7-4-12(5-8-23)9-13-10-14-17(21)16(20)11-15(19(22)24)18(14)25-13/h10-12H,2-9,21H2,1H3,(H2,22,24) |
| InChIKey | GIIPVXXSDJVPKQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|