C23H35ClN2O4 — CID 23207727
5-amino-6-chloro-8-[(1-octylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (PubChem CID 23207727) has the molecular formula C23H35ClN2O4 and a molecular weight of 439.00 g/mol. Its IUPAC name is 5-amino-6-chloro-8-[(1-octylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
| Compound Name | 5-amino-6-chloro-8-[(1-octylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
|---|---|
| PubChem CID | 23207727 |
| Molecular Formula | C23H35ClN2O4 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-amino-6-chloro-8-[(1-octylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| SMILES | CCCCCCCCN1CCC(Cc2cc(Cl)c(N)c3c2OCC(C(=O)O)O3)CC1 |
| InChI | InChI=1S/C23H35ClN2O4/c1-2-3-4-5-6-7-10-26-11-8-16(9-12-26)13-17-14-18(24)20(25)22-21(17)29-15-19(30-22)23(27)28/h14,16,19H,2-13,15,25H2,1H3,(H,27,28) |
| InChIKey | XWCRFVJBXARSRR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|