C24H37ClN2O4 — CID 67593039
5-amino-6-chloro-3-methyl-8-(1-nonylpiperidin-4-yl)-2H-1,4-benzodioxine-3-carboxylic acid (PubChem CID 67593039) has the molecular formula C24H37ClN2O4 and a molecular weight of 453.02 g/mol. Its IUPAC name is 5-amino-6-chloro-3-methyl-8-(1-nonylpiperidin-4-yl)-2H-1,4-benzodioxine-3-carboxylic acid.
| Compound Name | 5-amino-6-chloro-3-methyl-8-(1-nonylpiperidin-4-yl)-2H-1,4-benzodioxine-3-carboxylic acid |
|---|---|
| PubChem CID | 67593039 |
| Molecular Formula | C24H37ClN2O4 |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 5-amino-6-chloro-3-methyl-8-(1-nonylpiperidin-4-yl)-2H-1,4-benzodioxine-3-carboxylic acid |
| SMILES | CCCCCCCCCN1CCC(c2cc(Cl)c(N)c3c2OCC(C)(C(=O)O)O3)CC1 |
| InChI | InChI=1S/C24H37ClN2O4/c1-3-4-5-6-7-8-9-12-27-13-10-17(11-14-27)18-15-19(25)20(26)22-21(18)30-16-24(2,31-22)23(28)29/h15,17H,3-14,16,26H2,1-2H3,(H,28,29) |
| InChIKey | CIWLFPBNANYTHJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|