C17H24ClN3O3 — CID 23366983
5-amino-6-chloro-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-8-carboxamide (PubChem CID 23366983) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 5-amino-6-chloro-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-8-carboxamide.
| Compound Name | 5-amino-6-chloro-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-8-carboxamide |
|---|---|
| PubChem CID | 23366983 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 5-amino-6-chloro-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-8-carboxamide |
| SMILES | CCN1CCC(N(C)C(=O)c2cc(Cl)c(N)c3c2OCCO3)CC1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-3-21-6-4-11(5-7-21)20(2)17(22)12-10-13(18)14(19)16-15(12)23-8-9-24-16/h10-11H,3-9,19H2,1-2H3 |
| InChIKey | JKIREIUBYMLDIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|