About piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate
piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate (PubChem CID 141066771) has the molecular formula C15H19ClN2O4
and a molecular weight of 326.78 g/mol. Its IUPAC name is piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate.
Molecular Properties
| Compound Name | piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate |
| PubChem CID | 141066771 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate |
| SMILES | Nc1c(Cl)cc(C(=O)OCN2CCCCC2)c2c1OCCO2 |
| InChI | InChI=1S/C15H19ClN2O4/c16-11-8-10(13-14(12(11)17)21-7-6-20-13)15(19)22-9-18-4-2-1-3-5-18/h8H,1-7,9,17H2 |
| InChIKey | CHQORBKTFLJLHV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate?
The IUPAC name of piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate (CID 141066771) is piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate.
What is the SMILES notation for piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate?
The canonical SMILES for piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate is Nc1c(Cl)cc(C(=O)OCN2CCCCC2)c2c1OCCO2.
What is the InChIKey of piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate?
The InChIKey is CHQORBKTFLJLHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O4/c16-11-8-10(13-14(12(11)17)21-7-6-20-13)15(19)22-9-18-4-2-1-3-5-18/h8H,1-7,9,17H2.
What are the key properties of piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate?
piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate has a molecular weight of 326.78 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate is sourced from PubChem (CID 141066771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).