C15H19ClN2O4 — CID 141066771
piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate (PubChem CID 141066771) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate.
| Compound Name | piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate |
|---|---|
| PubChem CID | 141066771 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | piperidin-1-ylmethyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate |
| SMILES | Nc1c(Cl)cc(C(=O)OCN2CCCCC2)c2c1OCCO2 |
| InChI | InChI=1S/C15H19ClN2O4/c16-11-8-10(13-14(12(11)17)21-7-6-20-13)15(19)22-9-18-4-2-1-3-5-18/h8H,1-7,9,17H2 |
| InChIKey | CHQORBKTFLJLHV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|