C19H27ClN2O7 — CID 54092099
[(3R,4R)-3-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate (PubChem CID 54092099) has the molecular formula C19H27ClN2O7 and a molecular weight of 430.89 g/mol. Its IUPAC name is [(3R,4R)-3-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate.
| Compound Name | [(3R,4R)-3-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate |
|---|---|
| PubChem CID | 54092099 |
| Molecular Formula | C19H27ClN2O7 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [(3R,4R)-3-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate |
| SMILES | Nc1c(Cl)cc(C(=O)OC[C@H]2CCN(CCOCCO)C[C@@H]2O)c2c1OCCO2 |
| InChI | InChI=1S/C19H27ClN2O7/c20-14-9-13(17-18(16(14)21)28-8-7-27-17)19(25)29-11-12-1-2-22(10-15(12)24)3-5-26-6-4-23/h9,12,15,23-24H,1-8,10-11,21H2/t12-,15+/m1/s1 |
| InChIKey | MUOOMPRPQBETKH-DOMZBBRYSA-N |
| XLogP | 0.54 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|