C21H29ClN2O10 — CID 70169574
[(3S,4S)-3-hydroxy-1-(3-methoxypropyl)piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate;oxalic acid (PubChem CID 70169574) has the molecular formula C21H29ClN2O10 and a molecular weight of 504.92 g/mol. Its IUPAC name is [(3S,4S)-3-hydroxy-1-(3-methoxypropyl)piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate;oxalic acid.
| Compound Name | [(3S,4S)-3-hydroxy-1-(3-methoxypropyl)piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 70169574 |
| Molecular Formula | C21H29ClN2O10 |
| Molecular Weight | 504.92 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [(3S,4S)-3-hydroxy-1-(3-methoxypropyl)piperidin-4-yl]methyl 5-amino-6-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylate;oxalic acid |
| SMILES | COCCCN1CC[C@@H](COC(=O)c2cc(Cl)c(N)c3c2OCCO3)[C@H](O)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H27ClN2O6.C2H2O4/c1-25-6-2-4-22-5-3-12(15(23)10-22)11-28-19(24)13-9-14(20)16(21)18-17(13)26-7-8-27-18;3-1(4)2(5)6/h9,12,15,23H,2-8,10-11,21H2,1H3;(H,3,4)(H,5,6)/t12-,15+;/m0./s1 |
| InChIKey | DMKAUNOGUNATGY-SBKWZQTDSA-N |
| XLogP | 0.73 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.92 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|