C20H31Cl2N3O3 — CID 70095433
2-(5-amino-6-chloro-2,3-dihydro-1,4-benzodioxin-8-yl)-2-(1-pentylpiperidin-4-yl)acetamide;hydrochloride (PubChem CID 70095433) has the molecular formula C20H31Cl2N3O3 and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-(5-amino-6-chloro-2,3-dihydro-1,4-benzodioxin-8-yl)-2-(1-pentylpiperidin-4-yl)acetamide;hydrochloride.
| Compound Name | 2-(5-amino-6-chloro-2,3-dihydro-1,4-benzodioxin-8-yl)-2-(1-pentylpiperidin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70095433 |
| Molecular Formula | C20H31Cl2N3O3 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-(5-amino-6-chloro-2,3-dihydro-1,4-benzodioxin-8-yl)-2-(1-pentylpiperidin-4-yl)acetamide;hydrochloride |
| SMILES | CCCCCN1CCC(C(C(N)=O)c2cc(Cl)c(N)c3c2OCCO3)CC1.Cl |
| InChI | InChI=1S/C20H30ClN3O3.ClH/c1-2-3-4-7-24-8-5-13(6-9-24)16(20(23)25)14-12-15(21)17(22)19-18(14)26-10-11-27-19;/h12-13,16H,2-11,22H2,1H3,(H2,23,25);1H |
| InChIKey | NWNPRRRCJXHFRU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|