C20H30Cl2N2O4 — CID 67720139
[1-(3-propoxypropyl)piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate;hydrochloride (PubChem CID 67720139) has the molecular formula C20H30Cl2N2O4 and a molecular weight of 433.38 g/mol. Its IUPAC name is [1-(3-propoxypropyl)piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate;hydrochloride.
| Compound Name | [1-(3-propoxypropyl)piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67720139 |
| Molecular Formula | C20H30Cl2N2O4 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [1-(3-propoxypropyl)piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate;hydrochloride |
| SMILES | CCCOCCCN1CCC(OC(=O)c2cc(Cl)c(N)c3c2OCC3)CC1.Cl |
| InChI | InChI=1S/C20H29ClN2O4.ClH/c1-2-10-25-11-3-7-23-8-4-14(5-9-23)27-20(24)16-13-17(21)18(22)15-6-12-26-19(15)16;/h13-14H,2-12,22H2,1H3;1H |
| InChIKey | VRLZYQVPXUQULU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|