C29H35ClN2O11 — CID 67606533
oxalic acid;[1-[4-oxo-4-(3,4,5-trimethoxyphenyl)butyl]piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate (PubChem CID 67606533) has the molecular formula C29H35ClN2O11 and a molecular weight of 623.06 g/mol. Its IUPAC name is oxalic acid;[1-[4-oxo-4-(3,4,5-trimethoxyphenyl)butyl]piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate.
| Compound Name | oxalic acid;[1-[4-oxo-4-(3,4,5-trimethoxyphenyl)butyl]piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 67606533 |
| Molecular Formula | C29H35ClN2O11 |
| Molecular Weight | 623.06 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | oxalic acid;[1-[4-oxo-4-(3,4,5-trimethoxyphenyl)butyl]piperidin-4-yl] 4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylate |
| SMILES | COc1cc(C(=O)CCCN2CCC(OC(=O)c3cc(Cl)c(N)c4c3OCC4)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H33ClN2O7.C2H2O4/c1-33-22-13-16(14-23(34-2)26(22)35-3)21(31)5-4-9-30-10-6-17(7-11-30)37-27(32)19-15-20(28)24(29)18-8-12-36-25(18)19;3-1(4)2(5)6/h13-15,17H,4-12,29H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ORAPIDJISNESOS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 184.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.06 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|