C15H13Cl2FN4O2 — CID 138483855
5-chloro-4-[4-[(2-chloro-4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 138483855) has the molecular formula C15H13Cl2FN4O2 and a molecular weight of 371.20 g/mol. Its IUPAC name is 5-chloro-4-[4-[(2-chloro-4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[4-[(2-chloro-4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 138483855 |
| Molecular Formula | C15H13Cl2FN4O2 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 5-chloro-4-[4-[(2-chloro-4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | O=C1CN(c2cn[nH]c(=O)c2Cl)CCN1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H13Cl2FN4O2/c16-11-5-10(18)2-1-9(11)7-22-4-3-21(8-13(22)23)12-6-19-20-15(24)14(12)17/h1-2,5-6H,3-4,7-8H2,(H,20,24) |
| InChIKey | NZMZPJPDNUMVCG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |