C16H17ClN4O2 — CID 138484167
4-chloro-5-[4-[(2-methylphenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 138484167) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 4-chloro-5-[4-[(2-methylphenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 4-chloro-5-[4-[(2-methylphenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 138484167 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-chloro-5-[4-[(2-methylphenyl)methyl]-3-oxopiperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | Cc1ccccc1CN1CCN(c2c(Cl)cn[nH]c2=O)CC1=O |
| InChI | InChI=1S/C16H17ClN4O2/c1-11-4-2-3-5-12(11)9-20-6-7-21(10-14(20)22)15-13(17)8-18-19-16(15)23/h2-5,8H,6-7,9-10H2,1H3,(H,19,23) |
| InChIKey | GBFUFEHCPVEREH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |