C31H20F6N2 — CID 138484424
(Z)-1,1,1,5,5,5-hexafluoro-4-(9,9'-spirobi[fluorene]-2-ylmethylimino)pent-2-en-2-amine (PubChem CID 138484424) has the molecular formula C31H20F6N2 and a molecular weight of 534.50 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-(9,9'-spirobi[fluorene]-2-ylmethylimino)pent-2-en-2-amine.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-(9,9'-spirobi[fluorene]-2-ylmethylimino)pent-2-en-2-amine |
|---|---|
| PubChem CID | 138484424 |
| Molecular Formula | C31H20F6N2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-(9,9'-spirobi[fluorene]-2-ylmethylimino)pent-2-en-2-amine |
| SMILES | N/C(=C\C(=N\Cc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H20F6N2/c32-30(33,34)27(38)16-28(31(35,36)37)39-17-18-13-14-22-21-9-3-6-12-25(21)29(26(22)15-18)23-10-4-1-7-19(23)20-8-2-5-11-24(20)29/h1-16H,17,38H2/b27-16-,39-28- |
| InChIKey | UBZLCADDCMURLR-MKHMLTGXSA-N |
| XLogP | 7.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|