C27H18N2O4 — CID 23150327
(2'-carbamoyloxy-9,9'-spirobi[fluorene]-2-yl) carbamate (PubChem CID 23150327) has the molecular formula C27H18N2O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is (2'-carbamoyloxy-9,9'-spirobi[fluorene]-2-yl) carbamate.
| Compound Name | (2'-carbamoyloxy-9,9'-spirobi[fluorene]-2-yl) carbamate |
|---|---|
| PubChem CID | 23150327 |
| Molecular Formula | C27H18N2O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (2'-carbamoyloxy-9,9'-spirobi[fluorene]-2-yl) carbamate |
| SMILES | NC(=O)Oc1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2-c2ccc(OC(N)=O)cc21 |
| InChI | InChI=1S/C27H18N2O4/c28-25(30)32-15-9-11-19-17-5-1-3-7-21(17)27(23(19)13-15)22-8-4-2-6-18(22)20-12-10-16(14-24(20)27)33-26(29)31/h1-14H,(H2,28,30)(H2,29,31) |
| InChIKey | MRMGTAZSVZQLMM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |