C45H35O8S+ — CID 58320903
bis(4-acetyloxyphenyl)-[9,9-bis(4-acetyloxyphenyl)fluoren-2-yl]sulfanium (PubChem CID 58320903) has the molecular formula C45H35O8S+ and a molecular weight of 735.83 g/mol. Its IUPAC name is bis(4-acetyloxyphenyl)-[9,9-bis(4-acetyloxyphenyl)fluoren-2-yl]sulfanium.
| Compound Name | bis(4-acetyloxyphenyl)-[9,9-bis(4-acetyloxyphenyl)fluoren-2-yl]sulfanium |
|---|---|
| PubChem CID | 58320903 |
| Molecular Formula | C45H35O8S+ |
| Molecular Weight | 735.83 g/mol |
| Exact Mass | 735.20 |
| IUPAC Name | bis(4-acetyloxyphenyl)-[9,9-bis(4-acetyloxyphenyl)fluoren-2-yl]sulfanium |
| SMILES | CC(=O)Oc1ccc([S+](c2ccc(OC(C)=O)cc2)c2ccc3c(c2)C(c2ccc(OC(C)=O)cc2)(c2ccc(OC(C)=O)cc2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C45H35O8S/c1-28(46)50-34-13-9-32(10-14-34)45(33-11-15-35(16-12-33)51-29(2)47)43-8-6-5-7-41(43)42-26-25-40(27-44(42)45)54(38-21-17-36(18-22-38)52-30(3)48)39-23-19-37(20-24-39)53-31(4)49/h5-27H,1-4H3/q+1 |
| InChIKey | OUCLVTGJJGGHNC-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.83 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|