C44H37N3 — CID 138484674
2-(9,9-dimethylfluoren-2-yl)-4-naphthalen-1-yl-6-(5,9,9-trimethyl-5,6-dihydrofluoren-2-yl)-1,3,5-triazine (PubChem CID 138484674) has the molecular formula C44H37N3 and a molecular weight of 607.80 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-naphthalen-1-yl-6-(5,9,9-trimethyl-5,6-dihydrofluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-naphthalen-1-yl-6-(5,9,9-trimethyl-5,6-dihydrofluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 138484674 |
| Molecular Formula | C44H37N3 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-naphthalen-1-yl-6-(5,9,9-trimethyl-5,6-dihydrofluoren-2-yl)-1,3,5-triazine |
| SMILES | CC1CC=CC2=C1c1ccc(-c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)nc(-c4cccc5ccccc45)n3)cc1C2(C)C |
| InChI | InChI=1S/C44H37N3/c1-26-12-10-19-36-39(26)34-23-21-29(25-38(34)44(36,4)5)41-45-40(46-42(47-41)33-17-11-14-27-13-6-7-15-30(27)33)28-20-22-32-31-16-8-9-18-35(31)43(2,3)37(32)24-28/h6-11,13-26H,12H2,1-5H3 |
| InChIKey | KDLGVVXQVITBGL-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |