C13H24N4OS2 — CID 138485335
1-[4-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]butyl]-3-propan-2-ylthiourea (PubChem CID 138485335) has the molecular formula C13H24N4OS2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 1-[4-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]butyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]butyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 138485335 |
| Molecular Formula | C13H24N4OS2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[4-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]butyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NCCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C13H24N4OS2/c1-8(2)15-13(19)14-6-4-3-5-10-11-9(7-20-10)16-12(18)17-11/h8-11H,3-7H2,1-2H3,(H2,14,15,19)(H2,16,17,18)/t9-,10-,11-/m0/s1 |
| InChIKey | CVTQLUCVJORBFH-DCAQKATOSA-N |
| XLogP | 1.19 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|