C24H41NO — CID 138485654
1-[(2S)-pyrrolidin-2-yl]-1-(2,4,6-tritert-butylphenyl)ethanol (PubChem CID 138485654) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is 1-[(2S)-pyrrolidin-2-yl]-1-(2,4,6-tritert-butylphenyl)ethanol.
| Compound Name | 1-[(2S)-pyrrolidin-2-yl]-1-(2,4,6-tritert-butylphenyl)ethanol |
|---|---|
| PubChem CID | 138485654 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | 1-[(2S)-pyrrolidin-2-yl]-1-(2,4,6-tritert-butylphenyl)ethanol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(C)(O)[C@@H]2CCCN2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H41NO/c1-21(2,3)16-14-17(22(4,5)6)20(18(15-16)23(7,8)9)24(10,26)19-12-11-13-25-19/h14-15,19,25-26H,11-13H2,1-10H3/t19-,24?/m0/s1 |
| InChIKey | ILVPPHFRYGRIAV-XGLRFROISA-N |
| XLogP | 5.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |