amino 2-hydroxy-4-nitrosobenzoate

C7H6N2O4 — CID 138486238

IUPACamino 2-hydroxy-4-nitrosobenzoate
SMILESNOC(=O)c1ccc(N=O)cc1O
InChIInChI=1S/C7H6N2O4/c8-13-7(11)5-2-1-4(9-12)3-6(5)10/h1-3,10H,8H2
InChIKeyNEMHDWPXECVGTP-UHFFFAOYSA-N
MW182.14 g/mol
LogP0.82
Rot. Bonds2

About amino 2-hydroxy-4-nitrosobenzoate

amino 2-hydroxy-4-nitrosobenzoate (PubChem CID 138486238) has the molecular formula C7H6N2O4 and a molecular weight of 182.14 g/mol. Its IUPAC name is amino 2-hydroxy-4-nitrosobenzoate.

Molecular Properties

Compound Nameamino 2-hydroxy-4-nitrosobenzoate
PubChem CID138486238
Molecular FormulaC7H6N2O4
Molecular Weight182.14 g/mol
Exact Mass182.03
IUPAC Nameamino 2-hydroxy-4-nitrosobenzoate
SMILESNOC(=O)c1ccc(N=O)cc1O
InChIInChI=1S/C7H6N2O4/c8-13-7(11)5-2-1-4(9-12)3-6(5)10/h1-3,10H,8H2
InChIKeyNEMHDWPXECVGTP-UHFFFAOYSA-N
XLogP0.82
TPSA101.98 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.14
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 2-hydroxy-4-nitrosobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 2-hydroxy-4-nitrosobenzoate?
The IUPAC name of amino 2-hydroxy-4-nitrosobenzoate (CID 138486238) is amino 2-hydroxy-4-nitrosobenzoate.
What is the SMILES notation for amino 2-hydroxy-4-nitrosobenzoate?
The canonical SMILES for amino 2-hydroxy-4-nitrosobenzoate is NOC(=O)c1ccc(N=O)cc1O.
What is the InChIKey of amino 2-hydroxy-4-nitrosobenzoate?
The InChIKey is NEMHDWPXECVGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O4/c8-13-7(11)5-2-1-4(9-12)3-6(5)10/h1-3,10H,8H2.
What are the key properties of amino 2-hydroxy-4-nitrosobenzoate?
amino 2-hydroxy-4-nitrosobenzoate has a molecular weight of 182.14 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-hydroxy-4-nitrosobenzoate is sourced from PubChem (CID 138486238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).