C13H23N3 — CID 138487090
4-tert-butyl-N,N-diethyl-6-methylpyrimidin-2-amine (PubChem CID 138487090) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 4-tert-butyl-N,N-diethyl-6-methylpyrimidin-2-amine.
| Compound Name | 4-tert-butyl-N,N-diethyl-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 138487090 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 4-tert-butyl-N,N-diethyl-6-methylpyrimidin-2-amine |
| SMILES | CCN(CC)c1nc(C)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H23N3/c1-7-16(8-2)12-14-10(3)9-11(15-12)13(4,5)6/h9H,7-8H2,1-6H3 |
| InChIKey | VZJHVTIWDDRTKO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |