C10H13N — CID 138489498
5-cyclopropylcyclohepta-1,4,6-trien-1-amine (PubChem CID 138489498) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 5-cyclopropylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | 5-cyclopropylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 138489498 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 5-cyclopropylcyclohepta-1,4,6-trien-1-amine |
| SMILES | NC1=CCC=C(C2CC2)C=C1 |
| InChI | InChI=1S/C10H13N/c11-10-3-1-2-8(6-7-10)9-4-5-9/h2-3,6-7,9H,1,4-5,11H2 |
| InChIKey | QZEXZUSEFLMQRL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |