C30H28N2O4 — CID 138491883
ethyl 3-[3-[[5-methyl-2-(naphthalene-2-carbonylamino)benzoyl]amino]phenyl]propanoate (PubChem CID 138491883) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is ethyl 3-[3-[[5-methyl-2-(naphthalene-2-carbonylamino)benzoyl]amino]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[[5-methyl-2-(naphthalene-2-carbonylamino)benzoyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 138491883 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ethyl 3-[3-[[5-methyl-2-(naphthalene-2-carbonylamino)benzoyl]amino]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cccc(NC(=O)c2cc(C)ccc2NC(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C30H28N2O4/c1-3-36-28(33)16-12-21-7-6-10-25(18-21)31-30(35)26-17-20(2)11-15-27(26)32-29(34)24-14-13-22-8-4-5-9-23(22)19-24/h4-11,13-15,17-19H,3,12,16H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | HIKNCNJRFQVSQV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |