C29H26N2O4S — CID 138491051
ethyl 3-[3-[[2-[(4-thiophen-3-ylbenzoyl)amino]benzoyl]amino]phenyl]propanoate (PubChem CID 138491051) has the molecular formula C29H26N2O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is ethyl 3-[3-[[2-[(4-thiophen-3-ylbenzoyl)amino]benzoyl]amino]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[[2-[(4-thiophen-3-ylbenzoyl)amino]benzoyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 138491051 |
| Molecular Formula | C29H26N2O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | ethyl 3-[3-[[2-[(4-thiophen-3-ylbenzoyl)amino]benzoyl]amino]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cccc(NC(=O)c2ccccc2NC(=O)c2ccc(-c3ccsc3)cc2)c1 |
| InChI | InChI=1S/C29H26N2O4S/c1-2-35-27(32)15-10-20-6-5-7-24(18-20)30-29(34)25-8-3-4-9-26(25)31-28(33)22-13-11-21(12-14-22)23-16-17-36-19-23/h3-9,11-14,16-19H,2,10,15H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | OYKUSIKVEMNBQE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |