C26H23N3O2S — CID 141480922
N-[3-[(3-ethylphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide (PubChem CID 141480922) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is N-[3-[(3-ethylphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide.
| Compound Name | N-[3-[(3-ethylphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide |
|---|---|
| PubChem CID | 141480922 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[3-[(3-ethylphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide |
| SMILES | CCc1cccc(NC(=O)Nc2cc(NC(=O)c3ccccc3)ccc2-c2ccsc2)c1 |
| InChI | InChI=1S/C26H23N3O2S/c1-2-18-7-6-10-21(15-18)28-26(31)29-24-16-22(11-12-23(24)20-13-14-32-17-20)27-25(30)19-8-4-3-5-9-19/h3-17H,2H2,1H3,(H,27,30)(H2,28,29,31) |
| InChIKey | NQKOQOAIFCVHMK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |