C26H24N2O3S2 — CID 159015703
1-(5-benzylsulfonyl-2-thiophen-3-ylphenyl)-3-(3,4-dimethylphenyl)urea (PubChem CID 159015703) has the molecular formula C26H24N2O3S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 1-(5-benzylsulfonyl-2-thiophen-3-ylphenyl)-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-(5-benzylsulfonyl-2-thiophen-3-ylphenyl)-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 159015703 |
| Molecular Formula | C26H24N2O3S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-(5-benzylsulfonyl-2-thiophen-3-ylphenyl)-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(S(=O)(=O)Cc3ccccc3)ccc2-c2ccsc2)cc1C |
| InChI | InChI=1S/C26H24N2O3S2/c1-18-8-9-22(14-19(18)2)27-26(29)28-25-15-23(10-11-24(25)21-12-13-32-16-21)33(30,31)17-20-6-4-3-5-7-20/h3-16H,17H2,1-2H3,(H2,27,28,29) |
| InChIKey | JTBHFXYNAYILQQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |