C20H18F3N3O4S2 — CID 90101439
1-[5-(2-hydroxyethylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90101439) has the molecular formula C20H18F3N3O4S2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 1-[5-(2-hydroxyethylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-(2-hydroxyethylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90101439 |
| Molecular Formula | C20H18F3N3O4S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 1-[5-(2-hydroxyethylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(S(=O)(=O)NCCO)ccc1-c1ccsc1 |
| InChI | InChI=1S/C20H18F3N3O4S2/c21-20(22,23)14-2-1-3-15(10-14)25-19(28)26-18-11-16(32(29,30)24-7-8-27)4-5-17(18)13-6-9-31-12-13/h1-6,9-12,24,27H,7-8H2,(H2,25,26,28) |
| InChIKey | YOMYDPWOBJJRTQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |